C21H26F2N4O3 — CID 111865338
2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 111865338) has the molecular formula C21H26F2N4O3 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111865338 |
| Molecular Formula | C21H26F2N4O3 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | C/N=C(\NCc1cccc(OCC(=O)N(C)C)c1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C21H26F2N4O3/c1-24-21(26-13-16-8-4-5-10-18(16)30-20(22)23)25-12-15-7-6-9-17(11-15)29-14-19(28)27(2)3/h4-11,20H,12-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | RITJFIJGQFRCPR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|