C27H33IN4O2 — CID 111357047
2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111357047) has the molecular formula C27H33IN4O2 and a molecular weight of 572.49 g/mol. Its IUPAC name is 2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111357047 |
| Molecular Formula | C27H33IN4O2 |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | 2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(=O)N(C)C)c1)NCC(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C27H32N4O2.HI/c1-28-27(29-18-21-11-10-16-24(17-21)33-20-26(32)31(2)3)30-19-25(22-12-6-4-7-13-22)23-14-8-5-9-15-23;/h4-17,25H,18-20H2,1-3H3,(H2,28,29,30);1H |
| InChIKey | AALKHJUBEFEZEN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|