C16H25IN4O2 — CID 110979574
N,N-dimethyl-2-[3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 110979574) has the molecular formula C16H25IN4O2 and a molecular weight of 432.31 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110979574 |
| Molecular Formula | C16H25IN4O2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N,N-dimethyl-2-[3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCc1cccc(OCC(=O)N(C)C)c1.I |
| InChI | InChI=1S/C16H24N4O2.HI/c1-5-9-18-16(17-2)19-11-13-7-6-8-14(10-13)22-12-15(21)20(3)4;/h5-8,10H,1,9,11-12H2,2-4H3,(H2,17,18,19);1H |
| InChIKey | VBSFTHZMVFHBBV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|