C27H32N4O2 — CID 111356936
2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide (PubChem CID 111356936) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 111356936 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1cccc(CN/C(=N/C)NCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H32N4O2/c1-3-29-26(32)20-33-24-16-10-11-21(17-24)18-30-27(28-2)31-19-25(22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-17,25H,3,18-20H2,1-2H3,(H,29,32)(H2,28,30,31) |
| InChIKey | SLRISAHROHMXKP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|