C24H41N5O2 — CID 111937285
2-[3-[[[N-[2-(azepan-1-yl)-3-methylbutyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide (PubChem CID 111937285) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 2-[3-[[[N-[2-(azepan-1-yl)-3-methylbutyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[3-[[[N-[2-(azepan-1-yl)-3-methylbutyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 111937285 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 2-[3-[[[N-[2-(azepan-1-yl)-3-methylbutyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1cccc(CN/C(=N\C)NCC(C(C)C)N2CCCCCC2)c1 |
| InChI | InChI=1S/C24H41N5O2/c1-5-26-23(30)18-31-21-12-10-11-20(15-21)16-27-24(25-4)28-17-22(19(2)3)29-13-8-6-7-9-14-29/h10-12,15,19,22H,5-9,13-14,16-18H2,1-4H3,(H,26,30)(H2,25,27,28) |
| InChIKey | MDZUMGAJXKSSLJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|