C18H29IN4O3 — CID 111138930
N-ethyl-2-[3-[[[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111138930) has the molecular formula C18H29IN4O3 and a molecular weight of 476.36 g/mol. Its IUPAC name is N-ethyl-2-[3-[[[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N-ethyl-2-[3-[[[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111138930 |
| Molecular Formula | C18H29IN4O3 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-ethyl-2-[3-[[[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCNC(=O)COc1cccc(CN/C(=N/C)NCC2CCCO2)c1.I |
| InChI | InChI=1S/C18H28N4O3.HI/c1-3-20-17(23)13-25-15-7-4-6-14(10-15)11-21-18(19-2)22-12-16-8-5-9-24-16;/h4,6-7,10,16H,3,5,8-9,11-13H2,1-2H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | NWDCNFMBUANCEU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|