C21H36IN3O3 — CID 111409730
1-[(3-butoxyphenyl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111409730) has the molecular formula C21H36IN3O3 and a molecular weight of 505.44 g/mol. Its IUPAC name is 1-[(3-butoxyphenyl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-butoxyphenyl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111409730 |
| Molecular Formula | C21H36IN3O3 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 1-[(3-butoxyphenyl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCCCOc1cccc(CN/C(=N/C)NCCCOCC2CCCO2)c1.I |
| InChI | InChI=1S/C21H35N3O3.HI/c1-3-4-13-26-19-9-5-8-18(15-19)16-24-21(22-2)23-11-7-12-25-17-20-10-6-14-27-20;/h5,8-9,15,20H,3-4,6-7,10-14,16-17H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | LPIODXXWDYZXIB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|