C17H28N4O4S — CID 111408131
2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111408131) has the molecular formula C17H28N4O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111408131 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H28N4O4S/c1-19-17(20-8-4-9-24-13-15-6-3-10-25-15)21-12-14-5-2-7-16(11-14)26(18,22)23/h2,5,7,11,15H,3-4,6,8-10,12-13H2,1H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | PMSLCZASYYOPBZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|