C25H30N4O2 — CID 111330328
N-ethyl-2-[3-[[[N'-methyl-N-(1-naphthalen-1-ylethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111330328) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-ethyl-2-[3-[[[N'-methyl-N-(1-naphthalen-1-ylethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[3-[[[N'-methyl-N-(1-naphthalen-1-ylethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111330328 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-ethyl-2-[3-[[[N'-methyl-N-(1-naphthalen-1-ylethyl)carbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1cccc(CN/C(=N\C)NC(C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C25H30N4O2/c1-4-27-24(30)17-31-21-12-7-9-19(15-21)16-28-25(26-3)29-18(2)22-14-8-11-20-10-5-6-13-23(20)22/h5-15,18H,4,16-17H2,1-3H3,(H,27,30)(H2,26,28,29) |
| InChIKey | BQMYQHSNTPJPDE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|