C21H26F2N4O3 — CID 111864674
2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide (PubChem CID 111864674) has the molecular formula C21H26F2N4O3 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 111864674 |
| Molecular Formula | C21H26F2N4O3 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[3-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1cccc(CN/C(=N\C)NCc2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C21H26F2N4O3/c1-3-25-19(28)14-29-17-9-6-7-15(11-17)12-26-21(24-2)27-13-16-8-4-5-10-18(16)30-20(22)23/h4-11,20H,3,12-14H2,1-2H3,(H,25,28)(H2,24,26,27) |
| InChIKey | LEHSZNFOJUSAQF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|