C19H22F3IN4O3 — CID 111998964
2-[3-[[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111998964) has the molecular formula C19H22F3IN4O3 and a molecular weight of 538.31 g/mol. Its IUPAC name is 2-[3-[[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111998964 |
| Molecular Formula | C19H22F3IN4O3 |
| Molecular Weight | 538.31 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 2-[3-[[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCC(N)=O)c1)NCc1ccccc1OC(F)(F)F.I |
| InChI | InChI=1S/C19H21F3N4O3.HI/c1-24-18(25-10-13-5-4-7-15(9-13)28-12-17(23)27)26-11-14-6-2-3-8-16(14)29-19(20,21)22;/h2-9H,10-12H2,1H3,(H2,23,27)(H2,24,25,26);1H |
| InChIKey | NGGQYONMVLFFDE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|