C15H24N4O2 — CID 111761407
2-[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenoxy]acetamide (PubChem CID 111761407) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111761407 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenoxy]acetamide |
| SMILES | CCCCN/C(=N\C)NCc1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C15H24N4O2/c1-3-4-8-18-15(17-2)19-10-12-6-5-7-13(9-12)21-11-14(16)20/h5-7,9H,3-4,8,10-11H2,1-2H3,(H2,16,20)(H2,17,18,19) |
| InChIKey | SDQASSRMKBGLIW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|