C19H24FIN4O2 — CID 111763596
2-[3-[[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111763596) has the molecular formula C19H24FIN4O2 and a molecular weight of 486.33 g/mol. Its IUPAC name is 2-[3-[[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111763596 |
| Molecular Formula | C19H24FIN4O2 |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-[3-[[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCc1cccc(OCC(N)=O)c1.I |
| InChI | InChI=1S/C19H23FN4O2.HI/c1-22-19(23-10-9-14-5-7-16(20)8-6-14)24-12-15-3-2-4-17(11-15)26-13-18(21)25;/h2-8,11H,9-10,12-13H2,1H3,(H2,21,25)(H2,22,23,24);1H |
| InChIKey | FQLRMIKDYPZQNH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|