C18H31IN4O2 — CID 111986176
2-[3-[[[N'-methyl-N-(5-methylhexyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111986176) has the molecular formula C18H31IN4O2 and a molecular weight of 462.38 g/mol. Its IUPAC name is 2-[3-[[[N'-methyl-N-(5-methylhexyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N'-methyl-N-(5-methylhexyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111986176 |
| Molecular Formula | C18H31IN4O2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[3-[[[N'-methyl-N-(5-methylhexyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCCCC(C)C)NCc1cccc(OCC(N)=O)c1.I |
| InChI | InChI=1S/C18H30N4O2.HI/c1-14(2)7-4-5-10-21-18(20-3)22-12-15-8-6-9-16(11-15)24-13-17(19)23;/h6,8-9,11,14H,4-5,7,10,12-13H2,1-3H3,(H2,19,23)(H2,20,21,22);1H |
| InChIKey | ZCFXNIODWDUTKP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|