C20H33IN4O3 — CID 111768398
2-[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111768398) has the molecular formula C20H33IN4O3 and a molecular weight of 504.41 g/mol. Its IUPAC name is 2-[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111768398 |
| Molecular Formula | C20H33IN4O3 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCCOC1CCCCC1)NCc1cccc(OCC(N)=O)c1.I |
| InChI | InChI=1S/C20H32N4O3.HI/c1-22-20(23-11-6-12-26-17-8-3-2-4-9-17)24-14-16-7-5-10-18(13-16)27-15-19(21)25;/h5,7,10,13,17H,2-4,6,8-9,11-12,14-15H2,1H3,(H2,21,25)(H2,22,23,24);1H |
| InChIKey | TWAQOIVPHZLVOB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|