C19H30N4O2 — CID 111398307
3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111398307) has the molecular formula C19H30N4O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | 3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111398307 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCCCOC1CCCCC1)NCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C19H30N4O2/c1-21-19(22-11-6-12-25-17-9-3-2-4-10-17)23-14-15-7-5-8-16(13-15)18(20)24/h5,7-8,13,17H,2-4,6,9-12,14H2,1H3,(H2,20,24)(H2,21,22,23) |
| InChIKey | QVELZFVEKVEBON-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|