C25H41N5O2 — CID 111768327
1-[[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 111768327) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 1-[[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111768327 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | 1-[[3-[[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | C/N=C(\NCCCOC1CCCCC1)NCc1cccc(CN2CCCC(C(N)=O)C2)c1 |
| InChI | InChI=1S/C25H41N5O2/c1-27-25(28-13-7-15-32-23-11-3-2-4-12-23)29-17-20-8-5-9-21(16-20)18-30-14-6-10-22(19-30)24(26)31/h5,8-9,16,22-23H,2-4,6-7,10-15,17-19H2,1H3,(H2,26,31)(H2,27,28,29) |
| InChIKey | SUXLTBHAYJOMIF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|