C23H39IN6O — CID 111769166
1-[[3-[[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111769166) has the molecular formula C23H39IN6O and a molecular weight of 542.51 g/mol. Its IUPAC name is 1-[[3-[[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[[3-[[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111769166 |
| Molecular Formula | C23H39IN6O |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 1-[[3-[[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCN1CCCCC1)NCc1cccc(CN2CCCC(C(N)=O)C2)c1.I |
| InChI | InChI=1S/C23H38N6O.HI/c1-25-23(26-10-14-28-11-3-2-4-12-28)27-16-19-7-5-8-20(15-19)17-29-13-6-9-21(18-29)22(24)30;/h5,7-8,15,21H,2-4,6,9-14,16-18H2,1H3,(H2,24,30)(H2,25,26,27);1H |
| InChIKey | LKYYCOPWIPRZDM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|