C17H26N4O2 — CID 119877009
1-[[3-[[[(2R)-2-aminopropanoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 119877009) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[[3-[[[(2R)-2-aminopropanoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[[[(2R)-2-aminopropanoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119877009 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[[3-[[[(2R)-2-aminopropanoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | C[C@@H](N)C(=O)NCc1cccc(CN2CCCC(C(N)=O)C2)c1 |
| InChI | InChI=1S/C17H26N4O2/c1-12(18)17(23)20-9-13-4-2-5-14(8-13)10-21-7-3-6-15(11-21)16(19)22/h2,4-5,8,12,15H,3,6-7,9-11,18H2,1H3,(H2,19,22)(H,20,23)/t12-,15?/m1/s1 |
| InChIKey | TYGXTHUJQGTNHK-KEKZHRQWSA-N |
| XLogP | 0.35 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |