C18H26N4O3 — CID 166236592
1-[[3-[(prop-2-enoxycarbamoylamino)methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 166236592) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[[3-[(prop-2-enoxycarbamoylamino)methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[(prop-2-enoxycarbamoylamino)methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 166236592 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[[3-[(prop-2-enoxycarbamoylamino)methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | C=CCONC(=O)NCc1cccc(CN2CCCC(C(N)=O)C2)c1 |
| InChI | InChI=1S/C18H26N4O3/c1-2-9-25-21-18(24)20-11-14-5-3-6-15(10-14)12-22-8-4-7-16(13-22)17(19)23/h2-3,5-6,10,16H,1,4,7-9,11-13H2,(H2,19,23)(H2,20,21,24) |
| InChIKey | ZWZZICJVOYANLZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|