C24H34IN5OS — CID 111767298
1-[[3-[[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111767298) has the molecular formula C24H34IN5OS and a molecular weight of 567.54 g/mol. Its IUPAC name is 1-[[3-[[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[[3-[[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111767298 |
| Molecular Formula | C24H34IN5OS |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 1-[[3-[[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCSc1ccccc1)NCc1cccc(CN2CCCC(C(N)=O)C2)c1.I |
| InChI | InChI=1S/C24H33N5OS.HI/c1-26-24(27-12-14-31-22-10-3-2-4-11-22)28-16-19-7-5-8-20(15-19)17-29-13-6-9-21(18-29)23(25)30;/h2-5,7-8,10-11,15,21H,6,9,12-14,16-18H2,1H3,(H2,25,30)(H2,26,27,28);1H |
| InChIKey | XNYAAFVOOOSROX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|