C20H34IN5O — CID 111761312
1-[[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111761312) has the molecular formula C20H34IN5O and a molecular weight of 487.43 g/mol. Its IUPAC name is 1-[[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111761312 |
| Molecular Formula | C20H34IN5O |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-[[3-[[(N-butyl-N'-methylcarbamimidoyl)amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCCCN/C(=N\C)NCc1cccc(CN2CCCC(C(N)=O)C2)c1.I |
| InChI | InChI=1S/C20H33N5O.HI/c1-3-4-10-23-20(22-2)24-13-16-7-5-8-17(12-16)14-25-11-6-9-18(15-25)19(21)26;/h5,7-8,12,18H,3-4,6,9-11,13-15H2,1-2H3,(H2,21,26)(H2,22,23,24);1H |
| InChIKey | BVKUZZVQTWNMDV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|