C19H32IN5O — CID 111325211
3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111325211) has the molecular formula C19H32IN5O and a molecular weight of 473.40 g/mol. Its IUPAC name is 3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | 3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111325211 |
| Molecular Formula | C19H32IN5O |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCCCC1)NCc1cccc(C(N)=O)c1.I |
| InChI | InChI=1S/C19H31N5O.HI/c1-21-19(22-10-7-13-24-11-4-2-3-5-12-24)23-15-16-8-6-9-17(14-16)18(20)25;/h6,8-9,14H,2-5,7,10-13,15H2,1H3,(H2,20,25)(H2,21,22,23);1H |
| InChIKey | DKVIOCKIEYKMGN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|