C24H39N5O2 — CID 111325074
3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 111325074) has the molecular formula C24H39N5O2 and a molecular weight of 429.61 g/mol. Its IUPAC name is 3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111325074 |
| Molecular Formula | C24H39N5O2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | 3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | C/N=C(/NCCCN1CCCCCC1)NCc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C24H39N5O2/c1-25-24(26-12-8-15-29-13-4-2-3-5-14-29)28-18-20-9-6-10-21(17-20)23(30)27-19-22-11-7-16-31-22/h6,9-10,17,22H,2-5,7-8,11-16,18-19H2,1H3,(H,27,30)(H2,25,26,28) |
| InChIKey | BYTQTSJNAXFLLT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|