C22H35IN4O — CID 111797659
1-(3-cyclohexyloxypropyl)-3-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111797659) has the molecular formula C22H35IN4O and a molecular weight of 498.45 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-3-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-cyclohexyloxypropyl)-3-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111797659 |
| Molecular Formula | C22H35IN4O |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-3-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOC1CCCCC1)NCc1ccc(N2CC=CC2)cc1.I |
| InChI | InChI=1S/C22H34N4O.HI/c1-23-22(24-14-7-17-27-21-8-3-2-4-9-21)25-18-19-10-12-20(13-11-19)26-15-5-6-16-26;/h5-6,10-13,21H,2-4,7-9,14-18H2,1H3,(H2,23,24,25);1H |
| InChIKey | PSPACGFQNXJLCJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|