C22H26N6O2 — CID 111999293
2-[3-[[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111999293) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[3-[[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111999293 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-[3-[[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | C/N=C(/NCCc1ccc(-n2cccn2)cc1)NCc1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C22H26N6O2/c1-24-22(26-15-18-4-2-5-20(14-18)30-16-21(23)29)25-12-10-17-6-8-19(9-7-17)28-13-3-11-27-28/h2-9,11,13-14H,10,12,15-16H2,1H3,(H2,23,29)(H2,24,25,26) |
| InChIKey | NUICJMINTOAAPM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|