C23H32N4O4 — CID 111985933
2-[3-[[[N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111985933) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[3-[[[N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111985933 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-[3-[[[N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CCCN/C(=N/C)NCc2cccc(OCC(N)=O)c2)ccc1OC |
| InChI | InChI=1S/C23H32N4O4/c1-4-30-21-14-17(10-11-20(21)29-3)8-6-12-26-23(25-2)27-15-18-7-5-9-19(13-18)31-16-22(24)28/h5,7,9-11,13-14H,4,6,8,12,15-16H2,1-3H3,(H2,24,28)(H2,25,26,27) |
| InChIKey | WKVASAHIBBCFIS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|