C20H23F2N5O3 — CID 111864802
N-(2-amino-2-oxoethyl)-4-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111864802) has the molecular formula C20H23F2N5O3 and a molecular weight of 419.43 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111864802 |
| Molecular Formula | C20H23F2N5O3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1ccc(C(=O)NCC(N)=O)cc1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C20H23F2N5O3/c1-24-20(27-11-15-4-2-3-5-16(15)30-19(21)22)26-10-13-6-8-14(9-7-13)18(29)25-12-17(23)28/h2-9,19H,10-12H2,1H3,(H2,23,28)(H,25,29)(H2,24,26,27) |
| InChIKey | LNETVNCUOBITKF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|