C22H31IN4OS — CID 111704442
N-[3-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide (PubChem CID 111704442) has the molecular formula C22H31IN4OS and a molecular weight of 526.49 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111704442 |
| Molecular Formula | C22H31IN4OS |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(2-thiophen-3-ylpropyl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCC2)c1)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C22H30N4OS.HI/c1-16(19-10-11-28-15-19)13-24-22(23-2)25-14-17-6-5-9-20(12-17)26-21(27)18-7-3-4-8-18;/h5-6,9-12,15-16,18H,3-4,7-8,13-14H2,1-2H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | YWSKEEOBHIXCHM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|