C23H32IN5O — CID 111342638
N-[3-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111342638) has the molecular formula C23H32IN5O and a molecular weight of 521.45 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111342638 |
| Molecular Formula | C23H32IN5O |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)N2CCCC2)c1)NCC(C)c1ccccc1.I |
| InChI | InChI=1S/C23H31N5O.HI/c1-18(20-10-4-3-5-11-20)16-25-22(24-2)26-17-19-9-8-12-21(15-19)27-23(29)28-13-6-7-14-28;/h3-5,8-12,15,18H,6-7,13-14,16-17H2,1-2H3,(H,27,29)(H2,24,25,26);1H |
| InChIKey | JTHYONIYSWKCJR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|