C20H28IN5OS — CID 111897564
N-[3-[[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111897564) has the molecular formula C20H28IN5OS and a molecular weight of 513.45 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111897564 |
| Molecular Formula | C20H28IN5OS |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)N2CCCC2)c1)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C20H27N5OS.HI/c1-15-8-9-18(27-15)14-23-19(21-2)22-13-16-6-5-7-17(12-16)24-20(26)25-10-3-4-11-25;/h5-9,12H,3-4,10-11,13-14H2,1-2H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | IHORIHDOOICSOW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|