C24H40IN5O2 — CID 111624329
N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111624329) has the molecular formula C24H40IN5O2 and a molecular weight of 557.52 g/mol. Its IUPAC name is N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111624329 |
| Molecular Formula | C24H40IN5O2 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)N2CCCC2)c1)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C24H39N5O2.HI/c1-24(2,3)21-19(10-8-14-31-21)17-27-22(25-4)26-16-18-9-7-11-20(15-18)28-23(30)29-12-5-6-13-29;/h7,9,11,15,19,21H,5-6,8,10,12-14,16-17H2,1-4H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | IWYPMAJEGTXCCQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|