C24H39IN4O2 — CID 111623583
N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide (PubChem CID 111623583) has the molecular formula C24H39IN4O2 and a molecular weight of 542.51 g/mol. Its IUPAC name is N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111623583 |
| Molecular Formula | C24H39IN4O2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)C2CCC2)c1)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C24H38N4O2.HI/c1-24(2,3)21-19(11-7-13-30-21)16-27-23(25-4)26-15-17-8-5-12-20(14-17)28-22(29)18-9-6-10-18;/h5,8,12,14,18-19,21H,6-7,9-11,13,15-16H2,1-4H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | HDWOEFFYSMIYFI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|