C22H25F3N4O — CID 111420325
N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111420325) has the molecular formula C22H25F3N4O and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111420325 |
| Molecular Formula | C22H25F3N4O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | C/N=C(/NCc1ccc(C(F)(F)F)cc1)NCc1cccc(NC(=O)C2CCC2)c1 |
| InChI | InChI=1S/C22H25F3N4O/c1-26-21(27-13-15-8-10-18(11-9-15)22(23,24)25)28-14-16-4-2-7-19(12-16)29-20(30)17-5-3-6-17/h2,4,7-12,17H,3,5-6,13-14H2,1H3,(H,29,30)(H2,26,27,28) |
| InChIKey | PJLCVCXWMHVPOZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|