C24H40N4O2 — CID 111623318
N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide (PubChem CID 111623318) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 111623318 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | N-[3-[[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N\C)NCC2CCCOC2C(C)(C)C)c1 |
| InChI | InChI=1S/C24H40N4O2/c1-7-17(2)22(29)28-20-12-8-10-18(14-20)15-26-23(25-6)27-16-19-11-9-13-30-21(19)24(3,4)5/h8,10,12,14,17,19,21H,7,9,11,13,15-16H2,1-6H3,(H,28,29)(H2,25,26,27) |
| InChIKey | MZVLMCGXMIVMJV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|