C22H36N4O2 — CID 111624394
2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide (PubChem CID 111624394) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide.
| Compound Name | 2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 111624394 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide |
| SMILES | CCc1cccc(NC(=O)CN/C(=N\C)NCC2CCCOC2C(C)(C)C)c1 |
| InChI | InChI=1S/C22H36N4O2/c1-6-16-9-7-11-18(13-16)26-19(27)15-25-21(23-5)24-14-17-10-8-12-28-20(17)22(2,3)4/h7,9,11,13,17,20H,6,8,10,12,14-15H2,1-5H3,(H,26,27)(H2,23,24,25) |
| InChIKey | KGMWTRSDFHKGAY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|