C25H41IN4O3 — CID 111623425
N-[3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111623425) has the molecular formula C25H41IN4O3 and a molecular weight of 572.53 g/mol. Its IUPAC name is N-[3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111623425 |
| Molecular Formula | C25H41IN4O3 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | N-[3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C25H40N4O3.HI/c1-5-26-24(28-17-19-10-7-14-32-22(19)25(2,3)4)27-16-18-9-6-11-20(15-18)29-23(30)21-12-8-13-31-21;/h6,9,11,15,19,21-22H,5,7-8,10,12-14,16-17H2,1-4H3,(H,29,30)(H2,26,27,28);1H |
| InChIKey | DGMZTVXQKNPZRJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|