C20H33IN4O3 — CID 111623621
1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[(3-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111623621) has the molecular formula C20H33IN4O3 and a molecular weight of 504.41 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[(3-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111623621 |
| Molecular Formula | C20H33IN4O3 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-ethyl-2-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc([N+](=O)[O-])c1)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C20H32N4O3.HI/c1-5-21-19(22-13-15-8-6-10-17(12-15)24(25)26)23-14-16-9-7-11-27-18(16)20(2,3)4;/h6,8,10,12,16,18H,5,7,9,11,13-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | BBBPCTXQQVPTPF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|