C23H39IN4O2 — CID 111624289
4-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide;hydroiodide (PubChem CID 111624289) has the molecular formula C23H39IN4O2 and a molecular weight of 530.50 g/mol. Its IUPAC name is 4-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide;hydroiodide.
| Compound Name | 4-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111624289 |
| Molecular Formula | C23H39IN4O2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 4-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide;hydroiodide |
| SMILES | CCNC(=O)c1ccc(C/N=C(\NCC)NCC2CCCOC2C(C)(C)C)cc1.I |
| InChI | InChI=1S/C23H38N4O2.HI/c1-6-24-21(28)18-12-10-17(11-13-18)15-26-22(25-7-2)27-16-19-9-8-14-29-20(19)23(3,4)5;/h10-13,19-20H,6-9,14-16H2,1-5H3,(H,24,28)(H2,25,26,27);1H |
| InChIKey | XJTQXQOXGHLIGW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|