C25H43IN4O2 — CID 111623961
N-butan-2-yl-3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111623961) has the molecular formula C25H43IN4O2 and a molecular weight of 558.55 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111623961 |
| Molecular Formula | C25H43IN4O2 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | N-butan-2-yl-3-[[[[(2-tert-butyloxan-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C25H42N4O2.HI/c1-7-18(3)29-23(30)20-12-9-11-19(15-20)16-27-24(26-8-2)28-17-21-13-10-14-31-22(21)25(4,5)6;/h9,11-12,15,18,21-22H,7-8,10,13-14,16-17H2,1-6H3,(H,29,30)(H2,26,27,28);1H |
| InChIKey | ZQHMZJLISQPPLY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|