C23H36IN5O2 — CID 111594667
N-butan-2-yl-3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111594667) has the molecular formula C23H36IN5O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111594667 |
| Molecular Formula | C23H36IN5O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N-butan-2-yl-3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C23H35N5O2.HI/c1-7-16(3)28-21(29)18-11-9-10-17(12-18)13-26-22(24-8-2)27-15-20-25-14-19(30-20)23(4,5)6;/h9-12,14,16H,7-8,13,15H2,1-6H3,(H,28,29)(H2,24,26,27);1H |
| InChIKey | KUGIXSLJSJHGGH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|