C21H31N5O2 — CID 111594026
3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide (PubChem CID 111594026) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide.
| Compound Name | 3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 111594026 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 3-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(C/N=C(\NCC)NCc2ncc(C(C)(C)C)o2)c1 |
| InChI | InChI=1S/C21H31N5O2/c1-6-22-19(27)16-10-8-9-15(11-16)12-25-20(23-7-2)26-14-18-24-13-17(28-18)21(3,4)5/h8-11,13H,6-7,12,14H2,1-5H3,(H,22,27)(H2,23,25,26) |
| InChIKey | AFDZDFPNEMXJDS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|