C18H24ClFN4O — CID 111593838
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(3-chloro-4-fluorophenyl)methyl]-3-ethylguanidine (PubChem CID 111593838) has the molecular formula C18H24ClFN4O and a molecular weight of 366.87 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(3-chloro-4-fluorophenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(3-chloro-4-fluorophenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111593838 |
| Molecular Formula | C18H24ClFN4O |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(3-chloro-4-fluorophenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(Cl)c1)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C18H24ClFN4O/c1-5-21-17(23-9-12-6-7-14(20)13(19)8-12)24-11-16-22-10-15(25-16)18(2,3)4/h6-8,10H,5,9,11H2,1-4H3,(H2,21,23,24) |
| InChIKey | KYQXAFDEDQSNHT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|