C22H35N7O — CID 111595616
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111595616) has the molecular formula C22H35N7O and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111595616 |
| Molecular Formula | C22H35N7O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(C)CC2)c1)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C22H35N7O/c1-6-23-21(27-16-20-25-15-18(30-20)22(2,3)4)26-14-17-7-8-24-19(13-17)29-11-9-28(5)10-12-29/h7-8,13,15H,6,9-12,14,16H2,1-5H3,(H2,23,26,27) |
| InChIKey | BENZRMXADFFOQV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|