C19H34N6S — CID 111611872
1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111611872) has the molecular formula C19H34N6S and a molecular weight of 378.59 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111611872 |
| Molecular Formula | C19H34N6S |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(C)CC2)c1)NCC(C)(C)SC |
| InChI | InChI=1S/C19H34N6S/c1-6-20-18(23-15-19(2,3)26-5)22-14-16-7-8-21-17(13-16)25-11-9-24(4)10-12-25/h7-8,13H,6,9-12,14-15H2,1-5H3,(H2,20,22,23) |
| InChIKey | SHGJCAIMTPKKDU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|