C20H37IN6S — CID 111609451
1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111609451) has the molecular formula C20H37IN6S and a molecular weight of 520.53 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111609451 |
| Molecular Formula | C20H37IN6S |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(CC)CC2)c1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C20H36N6S.HI/c1-6-21-19(24-16-20(3,4)27-5)23-15-17-8-9-22-18(14-17)26-12-10-25(7-2)11-13-26;/h8-9,14H,6-7,10-13,15-16H2,1-5H3,(H2,21,23,24);1H |
| InChIKey | HAJIYTMVIPPDRM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|