C18H28N6 — CID 111848945
1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-prop-2-ynylguanidine (PubChem CID 111848945) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-prop-2-ynylguanidine.
| Compound Name | 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111848945 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/Cc1ccnc(N2CCN(CC)CC2)c1)NCC |
| InChI | InChI=1S/C18H28N6/c1-4-8-21-18(19-5-2)22-15-16-7-9-20-17(14-16)24-12-10-23(6-3)11-13-24/h1,7,9,14H,5-6,8,10-13,15H2,2-3H3,(H2,19,21,22) |
| InChIKey | LMYDTJDXYSOKQM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|