C20H31N7S — CID 111522534
1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111522534) has the molecular formula C20H31N7S and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111522534 |
| Molecular Formula | C20H31N7S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 1-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(CC)CC2)c1)NCc1ncc(C)s1 |
| InChI | InChI=1S/C20H31N7S/c1-4-21-20(25-15-19-23-13-16(3)28-19)24-14-17-6-7-22-18(12-17)27-10-8-26(5-2)9-11-27/h6-7,12-13H,4-5,8-11,14-15H2,1-3H3,(H2,21,24,25) |
| InChIKey | KVXOLSMMILRZRE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|