C23H32N6O — CID 111594518
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111594518) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111594518 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2C)c1)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C23H32N6O/c1-6-24-22(28-15-21-26-14-20(30-21)23(3,4)5)27-13-18-8-7-9-19(12-18)16-29-11-10-25-17(29)2/h7-12,14H,6,13,15-16H2,1-5H3,(H2,24,27,28) |
| InChIKey | FICOEBNNYVXVQZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|