C23H29FIN5 — CID 111845656
1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111845656) has the molecular formula C23H29FIN5 and a molecular weight of 521.42 g/mol. Its IUPAC name is 1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111845656 |
| Molecular Formula | C23H29FIN5 |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2C)c1)NCc1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C23H28FN5.HI/c1-4-25-23(28-15-20-9-8-17(2)22(24)13-20)27-14-19-6-5-7-21(12-19)16-29-11-10-26-18(29)3;/h5-13H,4,14-16H2,1-3H3,(H2,25,27,28);1H |
| InChIKey | DMNSCTIFEJQDGJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|